C24H26N2O2 — CID 40823073
(1S,3R,3aR,6aS)-3a-morpholin-4-yl-1,3-diphenyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-carbonitrile (PubChem CID 40823073) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-3a-morpholin-4-yl-1,3-diphenyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-carbonitrile.
| Compound Name | (1S,3R,3aR,6aS)-3a-morpholin-4-yl-1,3-diphenyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-carbonitrile |
|---|---|
| PubChem CID | 40823073 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (1S,3R,3aR,6aS)-3a-morpholin-4-yl-1,3-diphenyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-carbonitrile |
| SMILES | N#C[C@]1(c2ccccc2)O[C@H](c2ccccc2)[C@H]2CCC[C@@]21N1CCOCC1 |
| InChI | InChI=1S/C24H26N2O2/c25-18-24(20-10-5-2-6-11-20)23(26-14-16-27-17-15-26)13-7-12-21(23)22(28-24)19-8-3-1-4-9-19/h1-6,8-11,21-22H,7,12-17H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | BHMNGRKKDHUTQG-MOUTVQLLSA-N |
| XLogP | 4.05 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |