C16H21N — CID 11085524
1-[(1R,5S,6S)-6-phenyl-1-bicyclo[3.1.0]hexanyl]pyrrolidine (PubChem CID 11085524) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-[(1R,5S,6S)-6-phenyl-1-bicyclo[3.1.0]hexanyl]pyrrolidine.
| Compound Name | 1-[(1R,5S,6S)-6-phenyl-1-bicyclo[3.1.0]hexanyl]pyrrolidine |
|---|---|
| PubChem CID | 11085524 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-[(1R,5S,6S)-6-phenyl-1-bicyclo[3.1.0]hexanyl]pyrrolidine |
| SMILES | c1ccc([C@@H]2[C@@H]3CCC[C@]23N2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N/c1-2-7-13(8-3-1)15-14-9-6-10-16(14,15)17-11-4-5-12-17/h1-3,7-8,14-15H,4-6,9-12H2/t14-,15+,16+/m0/s1 |
| InChIKey | ZEKNCWBMRQXVHI-ARFHVFGLSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |