C14H19NO — CID 15744652
8a-methyl-2-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 15744652) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 8a-methyl-2-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | 8a-methyl-2-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 15744652 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 8a-methyl-2-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | CC12CCCCN1CC(c1ccccc1)O2 |
| InChI | InChI=1S/C14H19NO/c1-14-9-5-6-10-15(14)11-13(16-14)12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3 |
| InChIKey | LGYZGTNKSCEBNM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |