C15H22O4 — CID 141393277
1-(1,3-dihydroxypropan-2-yl)-2-phenylcyclohexane-1,3-diol (PubChem CID 141393277) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)-2-phenylcyclohexane-1,3-diol.
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)-2-phenylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 141393277 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)-2-phenylcyclohexane-1,3-diol |
| SMILES | OCC(CO)C1(O)CCCC(O)C1c1ccccc1 |
| InChI | InChI=1S/C15H22O4/c16-9-12(10-17)15(19)8-4-7-13(18)14(15)11-5-2-1-3-6-11/h1-3,5-6,12-14,16-19H,4,7-10H2 |
| InChIKey | BAWXZPSSKMXMQP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |