C21H30N2O2S — CID 10785644
N-methyl-N-[(2S)-4-[(3R)-3-methylpiperidin-1-yl]butan-2-yl]naphthalene-1-sulfonamide (PubChem CID 10785644) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-methyl-N-[(2S)-4-[(3R)-3-methylpiperidin-1-yl]butan-2-yl]naphthalene-1-sulfonamide.
| Compound Name | N-methyl-N-[(2S)-4-[(3R)-3-methylpiperidin-1-yl]butan-2-yl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10785644 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-methyl-N-[(2S)-4-[(3R)-3-methylpiperidin-1-yl]butan-2-yl]naphthalene-1-sulfonamide |
| SMILES | C[C@@H]1CCCN(CC[C@H](C)N(C)S(=O)(=O)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C21H30N2O2S/c1-17-8-7-14-23(16-17)15-13-18(2)22(3)26(24,25)21-12-6-10-19-9-4-5-11-20(19)21/h4-6,9-12,17-18H,7-8,13-16H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | XZYWRBPKJXHPIN-MSOLQXFVSA-N |
| XLogP | 3.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |