C12H12N2O4S — CID 107858246
6-oxo-N-phenylmethoxy-1H-pyridine-3-sulfonamide (PubChem CID 107858246) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 6-oxo-N-phenylmethoxy-1H-pyridine-3-sulfonamide.
| Compound Name | 6-oxo-N-phenylmethoxy-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107858246 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 6-oxo-N-phenylmethoxy-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NOCc2ccccc2)c[nH]1 |
| InChI | InChI=1S/C12H12N2O4S/c15-12-7-6-11(8-13-12)19(16,17)14-18-9-10-4-2-1-3-5-10/h1-8,14H,9H2,(H,13,15) |
| InChIKey | ACYWVGDBDNDPQH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|