C18H18F3N3O4S — CID 91087764
5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one (PubChem CID 91087764) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one.
| Compound Name | 5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 91087764 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)c[nH]1 |
| InChI | InChI=1S/C18H18F3N3O4S/c19-18(20,21)14-3-1-2-13(10-14)12-28-23-15-6-8-24(9-7-15)29(26,27)16-4-5-17(25)22-11-16/h1-6,10-11,23H,7-9,12H2,(H,22,25) |
| InChIKey | OAERYGCRBCZYMQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|