C9H11BrFNO2S — CID 107858602
1-bromo-N-[(1R)-1-(2-fluorophenyl)ethyl]methanesulfonamide (PubChem CID 107858602) has the molecular formula C9H11BrFNO2S and a molecular weight of 296.16 g/mol. Its IUPAC name is 1-bromo-N-[(1R)-1-(2-fluorophenyl)ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[(1R)-1-(2-fluorophenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 107858602 |
| Molecular Formula | C9H11BrFNO2S |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 1-bromo-N-[(1R)-1-(2-fluorophenyl)ethyl]methanesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CBr)c1ccccc1F |
| InChI | InChI=1S/C9H11BrFNO2S/c1-7(12-15(13,14)6-10)8-4-2-3-5-9(8)11/h2-5,7,12H,6H2,1H3/t7-/m1/s1 |
| InChIKey | SWZGRLLEXCZWCZ-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|