C12H21ClIN3 — CID 107859448
N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-1-iodo-3-methylbutan-2-amine (PubChem CID 107859448) has the molecular formula C12H21ClIN3 and a molecular weight of 369.68 g/mol. Its IUPAC name is N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-1-iodo-3-methylbutan-2-amine.
| Compound Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-1-iodo-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 107859448 |
| Molecular Formula | C12H21ClIN3 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-1-iodo-3-methylbutan-2-amine |
| SMILES | CCn1nc(C)c(Cl)c1CNC(CI)C(C)C |
| InChI | InChI=1S/C12H21ClIN3/c1-5-17-11(12(13)9(4)16-17)7-15-10(6-14)8(2)3/h8,10,15H,5-7H2,1-4H3 |
| InChIKey | RQABEFCWEZIZGN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|