C13H17ClINO — CID 107859884
2-chloro-N-(1-iodo-3-methylbutan-2-yl)-3-methylbenzamide (PubChem CID 107859884) has the molecular formula C13H17ClINO and a molecular weight of 365.64 g/mol. Its IUPAC name is 2-chloro-N-(1-iodo-3-methylbutan-2-yl)-3-methylbenzamide.
| Compound Name | 2-chloro-N-(1-iodo-3-methylbutan-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 107859884 |
| Molecular Formula | C13H17ClINO |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-chloro-N-(1-iodo-3-methylbutan-2-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(CI)C(C)C)c1Cl |
| InChI | InChI=1S/C13H17ClINO/c1-8(2)11(7-15)16-13(17)10-6-4-5-9(3)12(10)14/h4-6,8,11H,7H2,1-3H3,(H,16,17) |
| InChIKey | ACGNKQIERPFIOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|