C15H22INO — CID 107859920
N-(1-iodo-3-methylbutan-2-yl)-2-methyl-2-phenylpropanamide (PubChem CID 107859920) has the molecular formula C15H22INO and a molecular weight of 359.25 g/mol. Its IUPAC name is N-(1-iodo-3-methylbutan-2-yl)-2-methyl-2-phenylpropanamide.
| Compound Name | N-(1-iodo-3-methylbutan-2-yl)-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 107859920 |
| Molecular Formula | C15H22INO |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-(1-iodo-3-methylbutan-2-yl)-2-methyl-2-phenylpropanamide |
| SMILES | CC(C)C(CI)NC(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H22INO/c1-11(2)13(10-16)17-14(18)15(3,4)12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3,(H,17,18) |
| InChIKey | YYWIMKNMBBEMKL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|