C13H16F2INO — CID 107859944
2-(2,6-difluorophenyl)-N-(1-iodo-3-methylbutan-2-yl)acetamide (PubChem CID 107859944) has the molecular formula C13H16F2INO and a molecular weight of 367.18 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(1-iodo-3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-(1-iodo-3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 107859944 |
| Molecular Formula | C13H16F2INO |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(1-iodo-3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(CI)NC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2INO/c1-8(2)12(7-16)17-13(18)6-9-10(14)4-3-5-11(9)15/h3-5,8,12H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | CMROATXDSJNNBB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|