C17H19Br2NO — CID 107860710
(2R)-2-[1-(2,4-dibromophenyl)ethylamino]-3-phenylpropan-1-ol (PubChem CID 107860710) has the molecular formula C17H19Br2NO and a molecular weight of 413.15 g/mol. Its IUPAC name is (2R)-2-[1-(2,4-dibromophenyl)ethylamino]-3-phenylpropan-1-ol.
| Compound Name | (2R)-2-[1-(2,4-dibromophenyl)ethylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 107860710 |
| Molecular Formula | C17H19Br2NO |
| Molecular Weight | 413.15 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | (2R)-2-[1-(2,4-dibromophenyl)ethylamino]-3-phenylpropan-1-ol |
| SMILES | CC(N[C@@H](CO)Cc1ccccc1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H19Br2NO/c1-12(16-8-7-14(18)10-17(16)19)20-15(11-21)9-13-5-3-2-4-6-13/h2-8,10,12,15,20-21H,9,11H2,1H3/t12?,15-/m1/s1 |
| InChIKey | GXPJMTZPAXZRJC-WPZCJLIBSA-N |
| XLogP | 4.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |