C12H17Br2N — CID 60781142
N-[1-(2,4-dibromophenyl)ethyl]butan-2-amine (PubChem CID 60781142) has the molecular formula C12H17Br2N and a molecular weight of 335.08 g/mol. Its IUPAC name is N-[1-(2,4-dibromophenyl)ethyl]butan-2-amine.
| Compound Name | N-[1-(2,4-dibromophenyl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 60781142 |
| Molecular Formula | C12H17Br2N |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | N-[1-(2,4-dibromophenyl)ethyl]butan-2-amine |
| SMILES | CCC(C)NC(C)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br2N/c1-4-8(2)15-9(3)11-6-5-10(13)7-12(11)14/h5-9,15H,4H2,1-3H3 |
| InChIKey | IRCQMSRIXONKRD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |