C23H46O2Si — CID 10786171
(3S)-3-[(2S,3S)-3,7-dimethyl-7-triethylsilyloxyoctan-2-yl]-3-methylcyclohexan-1-one (PubChem CID 10786171) has the molecular formula C23H46O2Si and a molecular weight of 382.71 g/mol. Its IUPAC name is (3S)-3-[(2S,3S)-3,7-dimethyl-7-triethylsilyloxyoctan-2-yl]-3-methylcyclohexan-1-one.
| Compound Name | (3S)-3-[(2S,3S)-3,7-dimethyl-7-triethylsilyloxyoctan-2-yl]-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 10786171 |
| Molecular Formula | C23H46O2Si |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (3S)-3-[(2S,3S)-3,7-dimethyl-7-triethylsilyloxyoctan-2-yl]-3-methylcyclohexan-1-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@H](C)[C@H](C)[C@@]1(C)CCCC(=O)C1 |
| InChI | InChI=1S/C23H46O2Si/c1-9-26(10-2,11-3)25-22(6,7)16-12-14-19(4)20(5)23(8)17-13-15-21(24)18-23/h19-20H,9-18H2,1-8H3/t19-,20-,23-/m0/s1 |
| InChIKey | BEOHOXPPCUMLLZ-JTAQYXEDSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|