C15H14Cl3NO — CID 107862655
(2R)-2-phenyl-2-[(2,3,6-trichlorophenyl)methylamino]ethanol (PubChem CID 107862655) has the molecular formula C15H14Cl3NO and a molecular weight of 330.64 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[(2,3,6-trichlorophenyl)methylamino]ethanol.
| Compound Name | (2R)-2-phenyl-2-[(2,3,6-trichlorophenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 107862655 |
| Molecular Formula | C15H14Cl3NO |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | (2R)-2-phenyl-2-[(2,3,6-trichlorophenyl)methylamino]ethanol |
| SMILES | OC[C@H](NCc1c(Cl)ccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H14Cl3NO/c16-12-6-7-13(17)15(18)11(12)8-19-14(9-20)10-4-2-1-3-5-10/h1-7,14,19-20H,8-9H2/t14-/m0/s1 |
| InChIKey | UFJUSIKLUZOWQD-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|