C15H15Cl2NO — CID 95026876
(2R)-2-[(2,3-dichlorophenyl)methylamino]-2-phenylethanol (PubChem CID 95026876) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is (2R)-2-[(2,3-dichlorophenyl)methylamino]-2-phenylethanol.
| Compound Name | (2R)-2-[(2,3-dichlorophenyl)methylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 95026876 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (2R)-2-[(2,3-dichlorophenyl)methylamino]-2-phenylethanol |
| SMILES | OC[C@H](NCc1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H15Cl2NO/c16-13-8-4-7-12(15(13)17)9-18-14(10-19)11-5-2-1-3-6-11/h1-8,14,18-19H,9-10H2/t14-/m0/s1 |
| InChIKey | PUUBGNZNALEAMR-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |