C13H19BrN2O3 — CID 107865329
N-(3-bromophenyl)-2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]acetamide (PubChem CID 107865329) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 107865329 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(3-bromophenyl)-2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]acetamide |
| SMILES | CCC(CO)(CO)NCC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O3/c1-2-13(8-17,9-18)15-7-12(19)16-11-5-3-4-10(14)6-11/h3-6,15,17-18H,2,7-9H2,1H3,(H,16,19) |
| InChIKey | RPQSXLHVNGESQN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |