C16H28N2O3 — CID 107866668
1-(1-adamantyl)-3-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]urea (PubChem CID 107866668) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 107866668 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-(1-adamantyl)-3-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]urea |
| SMILES | CCC(CO)(CO)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H28N2O3/c1-2-15(9-19,10-20)17-14(21)18-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-13,19-20H,2-10H2,1H3,(H2,17,18,21) |
| InChIKey | QPDSAAABZQIRTO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |