C19H28N4O3S — CID 10786714
N-[2-[[6-(aminomethyl)-2-pyridinyl]methylamino]ethyl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide (PubChem CID 10786714) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[2-[[6-(aminomethyl)-2-pyridinyl]methylamino]ethyl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[[6-(aminomethyl)-2-pyridinyl]methylamino]ethyl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10786714 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[2-[[6-(aminomethyl)-2-pyridinyl]methylamino]ethyl]-N-(3-hydroxypropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCO)CCNCc2cccc(CN)n2)cc1 |
| InChI | InChI=1S/C19H28N4O3S/c1-16-6-8-19(9-7-16)27(25,26)23(11-3-13-24)12-10-21-15-18-5-2-4-17(14-20)22-18/h2,4-9,21,24H,3,10-15,20H2,1H3 |
| InChIKey | QTTCGMZQDJYQHX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|