C14H19Cl2NO3 — CID 107867479
N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,5-dimethoxybenzamide (PubChem CID 107867479) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,5-dimethoxybenzamide.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 107867479 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,5-dimethoxybenzamide |
| SMILES | CCC(CCl)(CCl)NC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H19Cl2NO3/c1-4-14(8-15,9-16)17-13(18)11-7-10(19-2)5-6-12(11)20-3/h5-7H,4,8-9H2,1-3H3,(H,17,18) |
| InChIKey | FMKAYGSZALQUAA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|