C13H16Br2N2O3 — CID 107867842
N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methyl-4-nitrobenzamide (PubChem CID 107867842) has the molecular formula C13H16Br2N2O3 and a molecular weight of 408.09 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methyl-4-nitrobenzamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 107867842 |
| Molecular Formula | C13H16Br2N2O3 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-methyl-4-nitrobenzamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H16Br2N2O3/c1-3-13(7-14,8-15)16-12(18)11-5-4-10(17(19)20)6-9(11)2/h4-6H,3,7-8H2,1-2H3,(H,16,18) |
| InChIKey | YOZAQDFOUHZYJM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|