C10H13Br2N3O3 — CID 107867981
N-[1-bromo-2-(bromomethyl)butan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 107867981) has the molecular formula C10H13Br2N3O3 and a molecular weight of 383.04 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107867981 |
| Molecular Formula | C10H13Br2N3O3 |
| Molecular Weight | 383.04 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C10H13Br2N3O3/c1-2-10(5-11,6-12)14-9(16)7-3-4-8(13-7)15(17)18/h3-4,13H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | YONWQKVVCIKVOJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.04 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|