C22H21NO6 — CID 10786858
(2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxylic acid (PubChem CID 10786858) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10786858 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxylic acid |
| SMILES | C=CCN1C(=O)[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-3-10-23-20(13-4-7-15(27-2)8-5-13)19(22(25)26)18(21(23)24)14-6-9-16-17(11-14)29-12-28-16/h3-9,11,18-20H,1,10,12H2,2H3,(H,25,26)/t18-,19-,20+/m1/s1 |
| InChIKey | JYDHDZXMTQSHEW-AQNXPRMDSA-N |
| XLogP | 2.98 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|