C13H15BrN4O — CID 107868791
4-amino-N-[(1R)-1-(4-bromophenyl)ethyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 107868791) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-amino-N-[(1R)-1-(4-bromophenyl)ethyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[(1R)-1-(4-bromophenyl)ethyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107868791 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 4-amino-N-[(1R)-1-(4-bromophenyl)ethyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)N[C@H](C)c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C13H15BrN4O/c1-7(9-3-5-10(14)6-4-9)16-13(19)12-11(15)8(2)17-18-12/h3-7H,15H2,1-2H3,(H,16,19)(H,17,18)/t7-/m1/s1 |
| InChIKey | FRTAHXPXEKWCDB-SSDOTTSWSA-N |
| XLogP | 2.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |