C18H33N3 — CID 107869311
1-N,1-N-bis(3-methylbutyl)-1-pyridin-3-ylpropane-1,2-diamine (PubChem CID 107869311) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-N,1-N-bis(3-methylbutyl)-1-pyridin-3-ylpropane-1,2-diamine.
| Compound Name | 1-N,1-N-bis(3-methylbutyl)-1-pyridin-3-ylpropane-1,2-diamine |
|---|---|
| PubChem CID | 107869311 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 1-N,1-N-bis(3-methylbutyl)-1-pyridin-3-ylpropane-1,2-diamine |
| SMILES | CC(C)CCN(CCC(C)C)C(c1cccnc1)C(C)N |
| InChI | InChI=1S/C18H33N3/c1-14(2)8-11-21(12-9-15(3)4)18(16(5)19)17-7-6-10-20-13-17/h6-7,10,13-16,18H,8-9,11-12,19H2,1-5H3 |
| InChIKey | OAWLWYVDVVGPOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |