C17H31N3O2S — CID 55989545
3-[1-[bis(3-methylbutyl)sulfamoylamino]ethyl]pyridine (PubChem CID 55989545) has the molecular formula C17H31N3O2S and a molecular weight of 341.52 g/mol. Its IUPAC name is 3-[1-[bis(3-methylbutyl)sulfamoylamino]ethyl]pyridine.
| Compound Name | 3-[1-[bis(3-methylbutyl)sulfamoylamino]ethyl]pyridine |
|---|---|
| PubChem CID | 55989545 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3-[1-[bis(3-methylbutyl)sulfamoylamino]ethyl]pyridine |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)NC(C)c1cccnc1 |
| InChI | InChI=1S/C17H31N3O2S/c1-14(2)8-11-20(12-9-15(3)4)23(21,22)19-16(5)17-7-6-10-18-13-17/h6-7,10,13-16,19H,8-9,11-12H2,1-5H3 |
| InChIKey | LNULCSJLYMOJTH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |