C16H36N2 — CID 107869452
2-ethyl-2-N,2-N-bis(3-methylbutyl)butane-1,2-diamine (PubChem CID 107869452) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 2-ethyl-2-N,2-N-bis(3-methylbutyl)butane-1,2-diamine.
| Compound Name | 2-ethyl-2-N,2-N-bis(3-methylbutyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 107869452 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 2-ethyl-2-N,2-N-bis(3-methylbutyl)butane-1,2-diamine |
| SMILES | CCC(CC)(CN)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C16H36N2/c1-7-16(8-2,13-17)18(11-9-14(3)4)12-10-15(5)6/h14-15H,7-13,17H2,1-6H3 |
| InChIKey | AEIILMGZTWPMMF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |