C17H38N2 — CID 107869505
3-methyl-2-N,2-N-bis(3-methylbutyl)hexane-1,2-diamine (PubChem CID 107869505) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 3-methyl-2-N,2-N-bis(3-methylbutyl)hexane-1,2-diamine.
| Compound Name | 3-methyl-2-N,2-N-bis(3-methylbutyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 107869505 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 3-methyl-2-N,2-N-bis(3-methylbutyl)hexane-1,2-diamine |
| SMILES | CCCC(C)C(CN)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C17H38N2/c1-7-8-16(6)17(13-18)19(11-9-14(2)3)12-10-15(4)5/h14-17H,7-13,18H2,1-6H3 |
| InChIKey | ABXOJNWFMHFVBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |