C18H31FN2 — CID 107870073
2-[(1S)-1-aminoethyl]-4-fluoro-N,N-bis(3-methylbutyl)aniline (PubChem CID 107870073) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-4-fluoro-N,N-bis(3-methylbutyl)aniline.
| Compound Name | 2-[(1S)-1-aminoethyl]-4-fluoro-N,N-bis(3-methylbutyl)aniline |
|---|---|
| PubChem CID | 107870073 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-4-fluoro-N,N-bis(3-methylbutyl)aniline |
| SMILES | CC(C)CCN(CCC(C)C)c1ccc(F)cc1[C@H](C)N |
| InChI | InChI=1S/C18H31FN2/c1-13(2)8-10-21(11-9-14(3)4)18-7-6-16(19)12-17(18)15(5)20/h6-7,12-15H,8-11,20H2,1-5H3/t15-/m0/s1 |
| InChIKey | XWKWZKMOQLAXRH-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |