C16H27FN2 — CID 28983277
2-[(1S)-1-aminoethyl]-N,N-dibutyl-4-fluoroaniline (PubChem CID 28983277) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-N,N-dibutyl-4-fluoroaniline.
| Compound Name | 2-[(1S)-1-aminoethyl]-N,N-dibutyl-4-fluoroaniline |
|---|---|
| PubChem CID | 28983277 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-N,N-dibutyl-4-fluoroaniline |
| SMILES | CCCCN(CCCC)c1ccc(F)cc1[C@H](C)N |
| InChI | InChI=1S/C16H27FN2/c1-4-6-10-19(11-7-5-2)16-9-8-14(17)12-15(16)13(3)18/h8-9,12-13H,4-7,10-11,18H2,1-3H3/t13-/m0/s1 |
| InChIKey | DQMYXBUGHMNQJI-ZDUSSCGKSA-N |
| XLogP | 4.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |