tert-butyl 2-[bis(3-methylbutyl)amino]propanoate

C17H35NO2 — CID 107870355

IUPACtert-butyl 2-[bis(3-methylbutyl)amino]propanoate
SMILESCC(C)CCN(CCC(C)C)C(C)C(=O)OC(C)(C)C
InChIInChI=1S/C17H35NO2/c1-13(2)9-11-18(12-10-14(3)4)15(5)16(19)20-17(6,7)8/h13-15H,9-12H2,1-8H3
InChIKeyXBNUFGAFMWANQD-UHFFFAOYSA-N
MW285.47 g/mol
LogP4.11
Rot. Bonds8

About tert-butyl 2-[bis(3-methylbutyl)amino]propanoate

tert-butyl 2-[bis(3-methylbutyl)amino]propanoate (PubChem CID 107870355) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is tert-butyl 2-[bis(3-methylbutyl)amino]propanoate.

Molecular Properties

Compound Nametert-butyl 2-[bis(3-methylbutyl)amino]propanoate
PubChem CID107870355
Molecular FormulaC17H35NO2
Molecular Weight285.47 g/mol
Exact Mass285.27
IUPAC Nametert-butyl 2-[bis(3-methylbutyl)amino]propanoate
SMILESCC(C)CCN(CCC(C)C)C(C)C(=O)OC(C)(C)C
InChIInChI=1S/C17H35NO2/c1-13(2)9-11-18(12-10-14(3)4)15(5)16(19)20-17(6,7)8/h13-15H,9-12H2,1-8H3
InChIKeyXBNUFGAFMWANQD-UHFFFAOYSA-N
XLogP4.11
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.47
LogP ≤ 54.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2-[bis(3-methylbutyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-[bis(3-methylbutyl)amino]propanoate?
The IUPAC name of tert-butyl 2-[bis(3-methylbutyl)amino]propanoate (CID 107870355) is tert-butyl 2-[bis(3-methylbutyl)amino]propanoate.
What is the SMILES notation for tert-butyl 2-[bis(3-methylbutyl)amino]propanoate?
The canonical SMILES for tert-butyl 2-[bis(3-methylbutyl)amino]propanoate is CC(C)CCN(CCC(C)C)C(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[bis(3-methylbutyl)amino]propanoate?
The InChIKey is XBNUFGAFMWANQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-13(2)9-11-18(12-10-14(3)4)15(5)16(19)20-17(6,7)8/h13-15H,9-12H2,1-8H3.
What are the key properties of tert-butyl 2-[bis(3-methylbutyl)amino]propanoate?
tert-butyl 2-[bis(3-methylbutyl)amino]propanoate has a molecular weight of 285.47 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[bis(3-methylbutyl)amino]propanoate is sourced from PubChem (CID 107870355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).