C18H40N2O — CID 107871434
N',N'-bis(3-methylbutyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine (PubChem CID 107871434) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is N',N'-bis(3-methylbutyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine.
| Compound Name | N',N'-bis(3-methylbutyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107871434 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | N',N'-bis(3-methylbutyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine |
| SMILES | CC(C)CCN(CCNCCCOC(C)C)CCC(C)C |
| InChI | InChI=1S/C18H40N2O/c1-16(2)8-12-20(13-9-17(3)4)14-11-19-10-7-15-21-18(5)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | QTHZYPPIGZYWNF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|