C12H28N2O3S — CID 79859053
N'-methyl-N'-(2-methylsulfonylethyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine (PubChem CID 79859053) has the molecular formula C12H28N2O3S and a molecular weight of 280.43 g/mol. Its IUPAC name is N'-methyl-N'-(2-methylsulfonylethyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(2-methylsulfonylethyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79859053 |
| Molecular Formula | C12H28N2O3S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N'-methyl-N'-(2-methylsulfonylethyl)-N-(3-propan-2-yloxypropyl)ethane-1,2-diamine |
| SMILES | CC(C)OCCCNCCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H28N2O3S/c1-12(2)17-10-5-6-13-7-8-14(3)9-11-18(4,15)16/h12-13H,5-11H2,1-4H3 |
| InChIKey | VSPJCFFLJGWGSJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|