C12H29N3O2S — CID 79859242
N-[2-(diethylamino)ethyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine (PubChem CID 79859242) has the molecular formula C12H29N3O2S and a molecular weight of 279.45 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79859242 |
| Molecular Formula | C12H29N3O2S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-methyl-N'-(2-methylsulfonylethyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H29N3O2S/c1-5-15(6-2)10-8-13-7-9-14(3)11-12-18(4,16)17/h13H,5-12H2,1-4H3 |
| InChIKey | HKGSYJGDPQXLQL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|