C26H26O2S — CID 10787312
(2R,4S,5R)-2,4-diethyl-2,4-diphenyl-5-phenylsulfanyloxolan-3-one (PubChem CID 10787312) has the molecular formula C26H26O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is (2R,4S,5R)-2,4-diethyl-2,4-diphenyl-5-phenylsulfanyloxolan-3-one.
| Compound Name | (2R,4S,5R)-2,4-diethyl-2,4-diphenyl-5-phenylsulfanyloxolan-3-one |
|---|---|
| PubChem CID | 10787312 |
| Molecular Formula | C26H26O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2R,4S,5R)-2,4-diethyl-2,4-diphenyl-5-phenylsulfanyloxolan-3-one |
| SMILES | CC[C@]1(c2ccccc2)O[C@H](Sc2ccccc2)[C@@](CC)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H26O2S/c1-3-25(20-14-8-5-9-15-20)23(27)26(4-2,21-16-10-6-11-17-21)28-24(25)29-22-18-12-7-13-19-22/h5-19,24H,3-4H2,1-2H3/t24-,25+,26-/m1/s1 |
| InChIKey | CWDAMZBQPSYECH-UODIDJSMSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |