C17H16O2S — CID 15373517
(4,4-dimethyl-3,1-benzoxathiin-2-yl)-phenylmethanone (PubChem CID 15373517) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is (4,4-dimethyl-3,1-benzoxathiin-2-yl)-phenylmethanone.
| Compound Name | (4,4-dimethyl-3,1-benzoxathiin-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 15373517 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (4,4-dimethyl-3,1-benzoxathiin-2-yl)-phenylmethanone |
| SMILES | CC1(C)OC(C(=O)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C17H16O2S/c1-17(2)13-10-6-7-11-14(13)20-16(19-17)15(18)12-8-4-3-5-9-12/h3-11,16H,1-2H3 |
| InChIKey | MJPDETVBKHMFDY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |