C13H20Cl2N2 — CID 107875611
5-tert-butyl-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine (PubChem CID 107875611) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 5-tert-butyl-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-tert-butyl-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 107875611 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-tert-butyl-N-(1,3-dichloro-2-methylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(CCl)(CCl)Nc1ccc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C13H20Cl2N2/c1-12(2,3)10-5-6-11(16-7-10)17-13(4,8-14)9-15/h5-7H,8-9H2,1-4H3,(H,16,17) |
| InChIKey | LZDWOAQVUVWQDG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|