C16H28N2 — CID 107874830
5-tert-butyl-N-(2,3,3-trimethylbutyl)pyridin-2-amine (PubChem CID 107874830) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 5-tert-butyl-N-(2,3,3-trimethylbutyl)pyridin-2-amine.
| Compound Name | 5-tert-butyl-N-(2,3,3-trimethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107874830 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 5-tert-butyl-N-(2,3,3-trimethylbutyl)pyridin-2-amine |
| SMILES | CC(CNc1ccc(C(C)(C)C)cn1)C(C)(C)C |
| InChI | InChI=1S/C16H28N2/c1-12(15(2,3)4)10-17-14-9-8-13(11-18-14)16(5,6)7/h8-9,11-12H,10H2,1-7H3,(H,17,18) |
| InChIKey | YTXVJLYMXQAURV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |