C19H31NO — CID 107876213
3-methyl-1-[[(3-methyl-2-phenylbutyl)amino]methyl]cyclohexan-1-ol (PubChem CID 107876213) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 3-methyl-1-[[(3-methyl-2-phenylbutyl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 3-methyl-1-[[(3-methyl-2-phenylbutyl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 107876213 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 3-methyl-1-[[(3-methyl-2-phenylbutyl)amino]methyl]cyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNCC(c2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C19H31NO/c1-15(2)18(17-9-5-4-6-10-17)13-20-14-19(21)11-7-8-16(3)12-19/h4-6,9-10,15-16,18,20-21H,7-8,11-14H2,1-3H3 |
| InChIKey | BVTKZVDZNHNELX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |