C16H22ClNO2 — CID 65120712
2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-2-phenylacetamide (PubChem CID 65120712) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 65120712 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]-2-phenylacetamide |
| SMILES | CC1CCCC(O)(CNC(=O)C(Cl)c2ccccc2)C1 |
| InChI | InChI=1S/C16H22ClNO2/c1-12-6-5-9-16(20,10-12)11-18-15(19)14(17)13-7-3-2-4-8-13/h2-4,7-8,12,14,20H,5-6,9-11H2,1H3,(H,18,19) |
| InChIKey | YSOSWPMNWWCGBT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|