C10H19NO2 — CID 36689616
N-[[(1R,3S)-1-hydroxy-3-methylcyclohexyl]methyl]acetamide (PubChem CID 36689616) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-[[(1R,3S)-1-hydroxy-3-methylcyclohexyl]methyl]acetamide.
| Compound Name | N-[[(1R,3S)-1-hydroxy-3-methylcyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 36689616 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-[[(1R,3S)-1-hydroxy-3-methylcyclohexyl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@]1(O)CCC[C@H](C)C1 |
| InChI | InChI=1S/C10H19NO2/c1-8-4-3-5-10(13,6-8)7-11-9(2)12/h8,13H,3-7H2,1-2H3,(H,11,12)/t8-,10+/m0/s1 |
| InChIKey | YHDKZEYGKLYRSE-WCBMZHEXSA-N |
| XLogP | 1.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |