C14H27BrN2O2 — CID 107877601
ethyl 4-[2-(bromomethyl)-3,3-dimethylbutyl]piperazine-1-carboxylate (PubChem CID 107877601) has the molecular formula C14H27BrN2O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is ethyl 4-[2-(bromomethyl)-3,3-dimethylbutyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(bromomethyl)-3,3-dimethylbutyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107877601 |
| Molecular Formula | C14H27BrN2O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 4-[2-(bromomethyl)-3,3-dimethylbutyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(CBr)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27BrN2O2/c1-5-19-13(18)17-8-6-16(7-9-17)11-12(10-15)14(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | SIPGJILBEPLAHP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|