C14H14FN3O2 — CID 107880293
2-fluoro-5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]benzonitrile (PubChem CID 107880293) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-fluoro-5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107880293 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-fluoro-5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]benzonitrile |
| SMILES | CN1C(=O)CCC(NCc2ccc(F)c(C#N)c2)C1=O |
| InChI | InChI=1S/C14H14FN3O2/c1-18-13(19)5-4-12(14(18)20)17-8-9-2-3-11(15)10(6-9)7-16/h2-3,6,12,17H,4-5,8H2,1H3 |
| InChIKey | CTGISSSCIYPNMS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|