C15H16ClFN2 — CID 107882083
4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-ethylbenzene-1,4-diamine (PubChem CID 107882083) has the molecular formula C15H16ClFN2 and a molecular weight of 278.76 g/mol. Its IUPAC name is 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-ethylbenzene-1,4-diamine.
| Compound Name | 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-ethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 107882083 |
| Molecular Formula | C15H16ClFN2 |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-ethylbenzene-1,4-diamine |
| SMILES | CCN(Cc1ccc(Cl)c(F)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H16ClFN2/c1-2-19(13-6-4-12(18)5-7-13)10-11-3-8-14(16)15(17)9-11/h3-9H,2,10,18H2,1H3 |
| InChIKey | PXERSBURUOTXPH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|