C16H18ClFN2 — CID 107882086
4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine (PubChem CID 107882086) has the molecular formula C16H18ClFN2 and a molecular weight of 292.79 g/mol. Its IUPAC name is 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 107882086 |
| Molecular Formula | C16H18ClFN2 |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-N-[(4-chloro-3-fluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(Cc1ccc(Cl)c(F)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H18ClFN2/c1-2-9-20(14-6-4-13(19)5-7-14)11-12-3-8-15(17)16(18)10-12/h3-8,10H,2,9,11,19H2,1H3 |
| InChIKey | ZTVABOSCFSALFD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|