C16H18F2N2 — CID 105404060
4-N-[(3,5-difluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine (PubChem CID 105404060) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-N-[(3,5-difluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-[(3,5-difluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 105404060 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-N-[(3,5-difluorophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(Cc1cc(F)cc(F)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H18F2N2/c1-2-7-20(16-5-3-15(19)4-6-16)11-12-8-13(17)10-14(18)9-12/h3-6,8-10H,2,7,11,19H2,1H3 |
| InChIKey | CXMAHAKQYZLIHQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|