C16H19IN2 — CID 65477008
4-N-[(4-iodophenyl)methyl]-4-N-propylbenzene-1,4-diamine (PubChem CID 65477008) has the molecular formula C16H19IN2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-N-[(4-iodophenyl)methyl]-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-[(4-iodophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 65477008 |
| Molecular Formula | C16H19IN2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-N-[(4-iodophenyl)methyl]-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(Cc1ccc(I)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H19IN2/c1-2-11-19(16-9-7-15(18)8-10-16)12-13-3-5-14(17)6-4-13/h3-10H,2,11-12,18H2,1H3 |
| InChIKey | JODMGRDKVXBPER-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|