About 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide
2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide (PubChem CID 10788294) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide.
Molecular Properties
| Compound Name | 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide |
| PubChem CID | 10788294 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide |
| SMILES | NC/C(N)=N\c1cccc(CN)c1 |
| InChI | InChI=1S/C9H14N4/c10-5-7-2-1-3-8(4-7)13-9(12)6-11/h1-4H,5-6,10-11H2,(H2,12,13) |
| InChIKey | BWNWOGRCONOOAQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide?
The IUPAC name of 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide (CID 10788294) is 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide.
What is the SMILES notation for 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide?
The canonical SMILES for 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide is NC/C(N)=N\c1cccc(CN)c1.
What is the InChIKey of 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide?
The InChIKey is BWNWOGRCONOOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c10-5-7-2-1-3-8(4-7)13-9(12)6-11/h1-4H,5-6,10-11H2,(H2,12,13).
What are the key properties of 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide?
2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide has a molecular weight of 178.24 g/mol, XLogP of 0.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-[3-(aminomethyl)phenyl]ethanimidamide is sourced from PubChem (CID 10788294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).