About 3-(aminomethyl)aniline
3-(aminomethyl)aniline (PubChem CID 4628831) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3-(aminomethyl)aniline.
Molecular Properties
| Compound Name | 3-(aminomethyl)aniline |
| PubChem CID | 4628831 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 3-(aminomethyl)aniline |
| SMILES | NCc1cccc(N)c1 |
| InChI | InChI=1S/C7H10N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5,8-9H2 |
| InChIKey | ZDBWYUOUYNQZBM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)aniline?
The IUPAC name of 3-(aminomethyl)aniline (CID 4628831) is 3-(aminomethyl)aniline.
What is the SMILES notation for 3-(aminomethyl)aniline?
The canonical SMILES for 3-(aminomethyl)aniline is NCc1cccc(N)c1.
What is the InChIKey of 3-(aminomethyl)aniline?
The InChIKey is ZDBWYUOUYNQZBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5,8-9H2.
What are the key properties of 3-(aminomethyl)aniline?
3-(aminomethyl)aniline has a molecular weight of 122.17 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)aniline is sourced from PubChem (CID 4628831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).